C12H14O3 — CID 102254828
(3S,4S,5R)-4-hydroxy-3,5-dimethyl-4-phenyloxolan-2-one (PubChem CID 102254828) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (3S,4S,5R)-4-hydroxy-3,5-dimethyl-4-phenyloxolan-2-one.
| Compound Name | (3S,4S,5R)-4-hydroxy-3,5-dimethyl-4-phenyloxolan-2-one |
|---|---|
| PubChem CID | 102254828 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (3S,4S,5R)-4-hydroxy-3,5-dimethyl-4-phenyloxolan-2-one |
| SMILES | C[C@@H]1C(=O)O[C@H](C)[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C12H14O3/c1-8-11(13)15-9(2)12(8,14)10-6-4-3-5-7-10/h3-9,14H,1-2H3/t8-,9-,12-/m1/s1 |
| InChIKey | YXZDJDJBHVJOCJ-KBVBSXBZSA-N |
| XLogP | 1.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |