C15H12O5 — CID 67630595
3,4,5-trihydroxy-4-phenyl-3H-chromen-2-one (PubChem CID 67630595) has the molecular formula C15H12O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is 3,4,5-trihydroxy-4-phenyl-3H-chromen-2-one.
| Compound Name | 3,4,5-trihydroxy-4-phenyl-3H-chromen-2-one |
|---|---|
| PubChem CID | 67630595 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 3,4,5-trihydroxy-4-phenyl-3H-chromen-2-one |
| SMILES | O=C1Oc2cccc(O)c2C(O)(c2ccccc2)C1O |
| InChI | InChI=1S/C15H12O5/c16-10-7-4-8-11-12(10)15(19,13(17)14(18)20-11)9-5-2-1-3-6-9/h1-8,13,16-17,19H |
| InChIKey | XYVXYNXEDKSBRA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|