C12H10O3 — CID 11217915
(1S,2S,6S)-2-hydroxy-2-phenyl-7-oxabicyclo[4.1.0]hept-4-en-3-one (PubChem CID 11217915) has the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is (1S,2S,6S)-2-hydroxy-2-phenyl-7-oxabicyclo[4.1.0]hept-4-en-3-one.
| Compound Name | (1S,2S,6S)-2-hydroxy-2-phenyl-7-oxabicyclo[4.1.0]hept-4-en-3-one |
|---|---|
| PubChem CID | 11217915 |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | (1S,2S,6S)-2-hydroxy-2-phenyl-7-oxabicyclo[4.1.0]hept-4-en-3-one |
| SMILES | O=C1C=C[C@@H]2O[C@@H]2[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C12H10O3/c13-10-7-6-9-11(15-9)12(10,14)8-4-2-1-3-5-8/h1-7,9,11,14H/t9-,11-,12+/m0/s1 |
| InChIKey | KAAOXWZHUJBKMQ-ZMLRMANQSA-N |
| XLogP | 0.78 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|