C8H8O3 — CID 101161981
(1S,2S,6S)-2-ethenyl-2-hydroxy-7-oxabicyclo[4.1.0]hept-4-en-3-one (PubChem CID 101161981) has the molecular formula C8H8O3 and a molecular weight of 152.15 g/mol. Its IUPAC name is (1S,2S,6S)-2-ethenyl-2-hydroxy-7-oxabicyclo[4.1.0]hept-4-en-3-one.
| Compound Name | (1S,2S,6S)-2-ethenyl-2-hydroxy-7-oxabicyclo[4.1.0]hept-4-en-3-one |
|---|---|
| PubChem CID | 101161981 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | (1S,2S,6S)-2-ethenyl-2-hydroxy-7-oxabicyclo[4.1.0]hept-4-en-3-one |
| SMILES | C=C[C@@]1(O)C(=O)C=C[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C8H8O3/c1-2-8(10)6(9)4-3-5-7(8)11-5/h2-5,7,10H,1H2/t5-,7-,8+/m0/s1 |
| InChIKey | PJZNTZDKGWLIAG-APQOSEDMSA-N |
| XLogP | -0.19 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|