C15H22O3 — CID 101465605
2-hydroxy-6,6-bis(pent-4-enyl)-2H-pyran-5-one (PubChem CID 101465605) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-hydroxy-6,6-bis(pent-4-enyl)-2H-pyran-5-one.
| Compound Name | 2-hydroxy-6,6-bis(pent-4-enyl)-2H-pyran-5-one |
|---|---|
| PubChem CID | 101465605 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2-hydroxy-6,6-bis(pent-4-enyl)-2H-pyran-5-one |
| SMILES | C=CCCCC1(CCCC=C)OC(O)C=CC1=O |
| InChI | InChI=1S/C15H22O3/c1-3-5-7-11-15(12-8-6-4-2)13(16)9-10-14(17)18-15/h3-4,9-10,14,17H,1-2,5-8,11-12H2 |
| InChIKey | NAMSLPLRTKDNBQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|