C16H24O4 — CID 132606212
(2S,3S)-2-[(1S)-1-hydroxyundec-10-enyl]-1,4-dioxaspiro[2.4]hept-6-en-5-one (PubChem CID 132606212) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (2S,3S)-2-[(1S)-1-hydroxyundec-10-enyl]-1,4-dioxaspiro[2.4]hept-6-en-5-one.
| Compound Name | (2S,3S)-2-[(1S)-1-hydroxyundec-10-enyl]-1,4-dioxaspiro[2.4]hept-6-en-5-one |
|---|---|
| PubChem CID | 132606212 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (2S,3S)-2-[(1S)-1-hydroxyundec-10-enyl]-1,4-dioxaspiro[2.4]hept-6-en-5-one |
| SMILES | C=CCCCCCCCC[C@H](O)[C@@H]1O[C@]12C=CC(=O)O2 |
| InChI | InChI=1S/C16H24O4/c1-2-3-4-5-6-7-8-9-10-13(17)15-16(20-15)12-11-14(18)19-16/h2,11-13,15,17H,1,3-10H2/t13-,15-,16+/m0/s1 |
| InChIKey | IDMZCDFNBBUAPY-CWRNSKLLSA-N |
| XLogP | 2.86 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|