C15H24O2Si — CID 53382000
trans-(2S,3R)-3-hydroxy-2-pent-4-enyl-2-(2-trimethylsilylethynyl)cyclopentan-1-one (PubChem CID 53382000) has the molecular formula C15H24O2Si and a molecular weight of 264.44 g/mol. Its IUPAC name is trans-(2S,3R)-3-hydroxy-2-pent-4-enyl-2-(2-trimethylsilylethynyl)cyclopentan-1-one.
| Compound Name | trans-(2S,3R)-3-hydroxy-2-pent-4-enyl-2-(2-trimethylsilylethynyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 53382000 |
| Molecular Formula | C15H24O2Si |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | trans-(2S,3R)-3-hydroxy-2-pent-4-enyl-2-(2-trimethylsilylethynyl)cyclopentan-1-one |
| SMILES | C=CCCC[C@@]1(C#C[Si](C)(C)C)C(=O)CC[C@H]1O |
| InChI | InChI=1S/C15H24O2Si/c1-5-6-7-10-15(11-12-18(2,3)4)13(16)8-9-14(15)17/h5,13,16H,1,6-10H2,2-4H3/t13-,15+/m1/s1 |
| InChIKey | KIGWRXVGGAMZLK-HIFRSBDPSA-N |
| XLogP | 2.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|