C11H18O3 — CID 57205835
[(2S,3S)-3-methyl-3-pent-4-enyloxiran-2-yl]methyl acetate (PubChem CID 57205835) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is [(2S,3S)-3-methyl-3-pent-4-enyloxiran-2-yl]methyl acetate.
| Compound Name | [(2S,3S)-3-methyl-3-pent-4-enyloxiran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 57205835 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | [(2S,3S)-3-methyl-3-pent-4-enyloxiran-2-yl]methyl acetate |
| SMILES | C=CCCC[C@]1(C)O[C@H]1COC(C)=O |
| InChI | InChI=1S/C11H18O3/c1-4-5-6-7-11(3)10(14-11)8-13-9(2)12/h4,10H,1,5-8H2,2-3H3/t10-,11-/m0/s1 |
| InChIKey | WOTRWKZYNXNFDL-QWRGUYRKSA-N |
| XLogP | 2.06 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|