C22H42O3 — CID 162941072
[(2S,3S)-3-methyl-3-[(4S,8S)-4,8,12-trimethyltridecyl]oxiran-2-yl]methyl acetate (PubChem CID 162941072) has the molecular formula C22H42O3 and a molecular weight of 354.58 g/mol. Its IUPAC name is [(2S,3S)-3-methyl-3-[(4S,8S)-4,8,12-trimethyltridecyl]oxiran-2-yl]methyl acetate.
| Compound Name | [(2S,3S)-3-methyl-3-[(4S,8S)-4,8,12-trimethyltridecyl]oxiran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162941072 |
| Molecular Formula | C22H42O3 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.31 |
| IUPAC Name | [(2S,3S)-3-methyl-3-[(4S,8S)-4,8,12-trimethyltridecyl]oxiran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@@]1(C)CCC[C@@H](C)CCC[C@@H](C)CCCC(C)C |
| InChI | InChI=1S/C22H42O3/c1-17(2)10-7-11-18(3)12-8-13-19(4)14-9-15-22(6)21(25-22)16-24-20(5)23/h17-19,21H,7-16H2,1-6H3/t18-,19-,21-,22-/m0/s1 |
| InChIKey | JKDTUPIBGMGXAM-LGGPRVQUSA-N |
| XLogP | 6.15 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|