C27H44O3 — CID 90035908
[2-methyl-2-(4,8,12-trimethyltridecyl)-3H-1-benzofuran-5-yl] acetate (PubChem CID 90035908) has the molecular formula C27H44O3 and a molecular weight of 416.65 g/mol. Its IUPAC name is [2-methyl-2-(4,8,12-trimethyltridecyl)-3H-1-benzofuran-5-yl] acetate.
| Compound Name | [2-methyl-2-(4,8,12-trimethyltridecyl)-3H-1-benzofuran-5-yl] acetate |
|---|---|
| PubChem CID | 90035908 |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | [2-methyl-2-(4,8,12-trimethyltridecyl)-3H-1-benzofuran-5-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)CC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C27H44O3/c1-20(2)10-7-11-21(3)12-8-13-22(4)14-9-17-27(6)19-24-18-25(29-23(5)28)15-16-26(24)30-27/h15-16,18,20-22H,7-14,17,19H2,1-6H3 |
| InChIKey | WFGAKEKEMXVWEW-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|