C26H43Na2O5P — CID 66561808
disodium;[2-methyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] phosphate (PubChem CID 66561808) has the molecular formula C26H43Na2O5P and a molecular weight of 512.58 g/mol. Its IUPAC name is disodium;[2-methyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] phosphate.
| Compound Name | disodium;[2-methyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] phosphate |
|---|---|
| PubChem CID | 66561808 |
| Molecular Formula | C26H43Na2O5P |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | disodium;[2-methyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] phosphate |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC1(C)CCc2cc(OP(=O)([O-])[O-])ccc2O1.[Na+].[Na+] |
| InChI | InChI=1S/C26H45O5P.2Na/c1-20(2)9-6-10-21(3)11-7-12-22(4)13-8-17-26(5)18-16-23-19-24(31-32(27,28)29)14-15-25(23)30-26;;/h14-15,19-22H,6-13,16-18H2,1-5H3,(H2,27,28,29);;/q;2*+1/p-2 |
| InChIKey | MUIIEMOLBHSBEL-UHFFFAOYSA-L |
| XLogP | 0.42 |
| TPSA | 81.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|