C58H98NaO6P — CID 53468605
sodium bis[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] phosphate (PubChem CID 53468605) has the molecular formula C58H98NaO6P and a molecular weight of 945.38 g/mol. Its IUPAC name is sodium bis[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] phosphate.
| Compound Name | sodium bis[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] phosphate |
|---|---|
| PubChem CID | 53468605 |
| Molecular Formula | C58H98NaO6P |
| Molecular Weight | 945.38 g/mol |
| Exact Mass | 944.70 |
| IUPAC Name | sodium bis[2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] phosphate |
| SMILES | Cc1c(C)c2c(c(C)c1OP(=O)([O-])Oc1c(C)c(C)c3c(c1C)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O3)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2.[Na+] |
| InChI | InChI=1S/C58H99O6P.Na/c1-39(2)23-17-25-41(5)27-19-29-43(7)31-21-35-57(15)37-33-51-49(13)53(45(9)47(11)55(51)61-57)63-65(59,60)64-54-46(10)48(12)56-52(50(54)14)34-38-58(16,62-56)36-22-32-44(8)30-20-28-42(6)26-18-24-40(3)4;/h39-44H,17-38H2,1-16H3,(H,59,60);/q;+1/p-1 |
| InChIKey | NWMIENMJQWEWBO-UHFFFAOYSA-M |
| XLogP | 14.51 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.38 |
| LogP ≤ 5 | 14.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|