C29H51O5P — CID 66750239
2-[[2-(4,8-dimethylnonyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]pentylphosphonic acid (PubChem CID 66750239) has the molecular formula C29H51O5P and a molecular weight of 510.70 g/mol. Its IUPAC name is 2-[[2-(4,8-dimethylnonyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]pentylphosphonic acid.
| Compound Name | 2-[[2-(4,8-dimethylnonyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]pentylphosphonic acid |
|---|---|
| PubChem CID | 66750239 |
| Molecular Formula | C29H51O5P |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.35 |
| IUPAC Name | 2-[[2-(4,8-dimethylnonyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]pentylphosphonic acid |
| SMILES | CCCC(CP(=O)(O)O)Oc1c(C)c(C)c2c(c1C)CCC(C)(CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C29H51O5P/c1-9-12-25(19-35(30,31)32)33-27-22(5)23(6)28-26(24(27)7)16-18-29(8,34-28)17-11-15-21(4)14-10-13-20(2)3/h20-21,25H,9-19H2,1-8H3,(H2,30,31,32) |
| InChIKey | RDNWSMIXOVWYRU-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|