C38H70O11P2 — CID 157061822
2-[2-[2-[hydroxy(propan-2-yloxy)phosphoryl]oxyethoxy]ethoxy]ethyl [(2S)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] hydrogen phosphate (PubChem CID 157061822) has the molecular formula C38H70O11P2 and a molecular weight of 764.91 g/mol. Its IUPAC name is 2-[2-[2-[hydroxy(propan-2-yloxy)phosphoryl]oxyethoxy]ethoxy]ethyl [(2S)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] hydrogen phosphate.
| Compound Name | 2-[2-[2-[hydroxy(propan-2-yloxy)phosphoryl]oxyethoxy]ethoxy]ethyl [(2S)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 157061822 |
| Molecular Formula | C38H70O11P2 |
| Molecular Weight | 764.91 g/mol |
| Exact Mass | 764.44 |
| IUPAC Name | 2-[2-[2-[hydroxy(propan-2-yloxy)phosphoryl]oxyethoxy]ethoxy]ethyl [(2S)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl] hydrogen phosphate |
| SMILES | Cc1c(C)c2c(c(C)c1OP(=O)(O)OCCOCCOCCOP(=O)(O)OC(C)C)CC[C@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C38H70O11P2/c1-28(2)14-11-15-30(5)16-12-17-31(6)18-13-20-38(10)21-19-35-34(9)36(32(7)33(8)37(35)47-38)49-51(41,42)46-27-25-44-23-22-43-24-26-45-50(39,40)48-29(3)4/h28-31H,11-27H2,1-10H3,(H,39,40)(H,41,42)/t30-,31-,38+/m1/s1 |
| InChIKey | ITWRQMWBODBBEQ-HFLUPYTBSA-N |
| XLogP | 10.21 |
| TPSA | 139.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.91 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|