C42H77O11P — CID 162464267
4-hydroxybutyl [2-hydroxy-3-[2-[2-[2-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]ethoxy]ethoxy]ethoxy]propyl] hydrogen phosphate (PubChem CID 162464267) has the molecular formula C42H77O11P and a molecular weight of 789.04 g/mol. Its IUPAC name is 4-hydroxybutyl [2-hydroxy-3-[2-[2-[2-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]ethoxy]ethoxy]ethoxy]propyl] hydrogen phosphate.
| Compound Name | 4-hydroxybutyl [2-hydroxy-3-[2-[2-[2-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]ethoxy]ethoxy]ethoxy]propyl] hydrogen phosphate |
|---|---|
| PubChem CID | 162464267 |
| Molecular Formula | C42H77O11P |
| Molecular Weight | 789.04 g/mol |
| Exact Mass | 788.52 |
| IUPAC Name | 4-hydroxybutyl [2-hydroxy-3-[2-[2-[2-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]ethoxy]ethoxy]ethoxy]propyl] hydrogen phosphate |
| SMILES | Cc1c(C)c2c(c(C)c1OCCOCCOCCOCC(O)COP(=O)(O)OCCCCO)CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C42H77O11P/c1-32(2)14-11-15-33(3)16-12-17-34(4)18-13-20-42(8)21-19-39-37(7)40(35(5)36(6)41(39)53-42)50-29-28-48-25-24-47-26-27-49-30-38(44)31-52-54(45,46)51-23-10-9-22-43/h32-34,38,43-44H,9-31H2,1-8H3,(H,45,46)/t33-,34-,38?,42-/m1/s1 |
| InChIKey | IUOCSLLXUACXKY-FQTCQCCWSA-N |
| XLogP | 8.83 |
| TPSA | 142.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.04 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|