C33H49NO4 — CID 11432441
[2-methyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-amino-3-hydroxybenzoate (PubChem CID 11432441) has the molecular formula C33H49NO4 and a molecular weight of 523.76 g/mol. Its IUPAC name is [2-methyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-amino-3-hydroxybenzoate.
| Compound Name | [2-methyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-amino-3-hydroxybenzoate |
|---|---|
| PubChem CID | 11432441 |
| Molecular Formula | C33H49NO4 |
| Molecular Weight | 523.76 g/mol |
| Exact Mass | 523.37 |
| IUPAC Name | [2-methyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] 2-amino-3-hydroxybenzoate |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC1(C)CCc2cc(OC(=O)c3cccc(O)c3N)ccc2O1 |
| InChI | InChI=1S/C33H49NO4/c1-23(2)10-6-11-24(3)12-7-13-25(4)14-9-20-33(5)21-19-26-22-27(17-18-30(26)38-33)37-32(36)28-15-8-16-29(35)31(28)34/h8,15-18,22-25,35H,6-7,9-14,19-21,34H2,1-5H3 |
| InChIKey | YYCYITGEBXOLID-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.76 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|