C23H38O5S — CID 87134645
1-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]butane-1-sulfonic acid (PubChem CID 87134645) has the molecular formula C23H38O5S and a molecular weight of 426.62 g/mol. Its IUPAC name is 1-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]butane-1-sulfonic acid.
| Compound Name | 1-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 87134645 |
| Molecular Formula | C23H38O5S |
| Molecular Weight | 426.62 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 1-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]butane-1-sulfonic acid |
| SMILES | CCCCCCCCCC1(C)CCc2cc(OC(CCC)S(=O)(=O)O)ccc2O1 |
| InChI | InChI=1S/C23H38O5S/c1-4-6-7-8-9-10-11-16-23(3)17-15-19-18-20(13-14-21(19)28-23)27-22(12-5-2)29(24,25)26/h13-14,18,22H,4-12,15-17H2,1-3H3,(H,24,25,26) |
| InChIKey | JWDWLLONDACDQR-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.62 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|