C26H42O4 — CID 59545007
7-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]heptanoic acid (PubChem CID 59545007) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is 7-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]heptanoic acid.
| Compound Name | 7-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]heptanoic acid |
|---|---|
| PubChem CID | 59545007 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | 7-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]heptanoic acid |
| SMILES | CCCCCCCCCC1(C)CCc2cc(OCCCCCCC(=O)O)ccc2O1 |
| InChI | InChI=1S/C26H42O4/c1-3-4-5-6-7-9-12-18-26(2)19-17-22-21-23(15-16-24(22)30-26)29-20-13-10-8-11-14-25(27)28/h15-16,21H,3-14,17-20H2,1-2H3,(H,27,28) |
| InChIKey | HGYUXMSUBPAMKL-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|