C24H33NO4 — CID 66752084
5-[[2-(8-cyanooct-1-enyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]pentanoic acid (PubChem CID 66752084) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is 5-[[2-(8-cyanooct-1-enyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]pentanoic acid.
| Compound Name | 5-[[2-(8-cyanooct-1-enyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]pentanoic acid |
|---|---|
| PubChem CID | 66752084 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 5-[[2-(8-cyanooct-1-enyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]pentanoic acid |
| SMILES | CC1(C=CCCCCCCC#N)CCc2cc(OCCCCC(=O)O)ccc2O1 |
| InChI | InChI=1S/C24H33NO4/c1-24(15-8-5-3-2-4-6-9-17-25)16-14-20-19-21(12-13-22(20)29-24)28-18-10-7-11-23(26)27/h8,12-13,15,19H,2-7,9-11,14,16,18H2,1H3,(H,26,27) |
| InChIKey | PKSLOWQWOCILKW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|