C22H32O4 — CID 66750324
3-[[2-(2-methylnon-1-enyl)-3,4-dihydro-2H-chromen-6-yl]oxy]propanoic acid (PubChem CID 66750324) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is 3-[[2-(2-methylnon-1-enyl)-3,4-dihydro-2H-chromen-6-yl]oxy]propanoic acid.
| Compound Name | 3-[[2-(2-methylnon-1-enyl)-3,4-dihydro-2H-chromen-6-yl]oxy]propanoic acid |
|---|---|
| PubChem CID | 66750324 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 3-[[2-(2-methylnon-1-enyl)-3,4-dihydro-2H-chromen-6-yl]oxy]propanoic acid |
| SMILES | CCCCCCCC(C)=CC1CCc2cc(OCCC(=O)O)ccc2O1 |
| InChI | InChI=1S/C22H32O4/c1-3-4-5-6-7-8-17(2)15-20-10-9-18-16-19(11-12-21(18)26-20)25-14-13-22(23)24/h11-12,15-16,20H,3-10,13-14H2,1-2H3,(H,23,24) |
| InChIKey | YTBAXMOAWVKTJS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|