C27H39NO4 — CID 66752714
8-[[2-(8-cyanooct-1-enyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]octanoic acid (PubChem CID 66752714) has the molecular formula C27H39NO4 and a molecular weight of 441.61 g/mol. Its IUPAC name is 8-[[2-(8-cyanooct-1-enyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]octanoic acid.
| Compound Name | 8-[[2-(8-cyanooct-1-enyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]octanoic acid |
|---|---|
| PubChem CID | 66752714 |
| Molecular Formula | C27H39NO4 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | 8-[[2-(8-cyanooct-1-enyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]octanoic acid |
| SMILES | CC1(C=CCCCCCCC#N)CCc2cc(OCCCCCCCC(=O)O)ccc2O1 |
| InChI | InChI=1S/C27H39NO4/c1-27(18-11-7-3-2-4-8-12-20-28)19-17-23-22-24(15-16-25(23)32-27)31-21-13-9-5-6-10-14-26(29)30/h11,15-16,18,22H,2-10,12-14,17,19,21H2,1H3,(H,29,30) |
| InChIKey | UPWOJKMLFXDIIC-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|