C25H41O5P — CID 66750322
2-[(2-methyl-2-non-1-enyl-3,4-dihydrochromen-6-yl)oxy]hexylphosphonic acid (PubChem CID 66750322) has the molecular formula C25H41O5P and a molecular weight of 452.57 g/mol. Its IUPAC name is 2-[(2-methyl-2-non-1-enyl-3,4-dihydrochromen-6-yl)oxy]hexylphosphonic acid.
| Compound Name | 2-[(2-methyl-2-non-1-enyl-3,4-dihydrochromen-6-yl)oxy]hexylphosphonic acid |
|---|---|
| PubChem CID | 66750322 |
| Molecular Formula | C25H41O5P |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 2-[(2-methyl-2-non-1-enyl-3,4-dihydrochromen-6-yl)oxy]hexylphosphonic acid |
| SMILES | CCCCCCCC=CC1(C)CCc2cc(OC(CCCC)CP(=O)(O)O)ccc2O1 |
| InChI | InChI=1S/C25H41O5P/c1-4-6-8-9-10-11-12-17-25(3)18-16-21-19-22(14-15-24(21)30-25)29-23(13-7-5-2)20-31(26,27)28/h12,14-15,17,19,23H,4-11,13,16,18,20H2,1-3H3,(H2,26,27,28) |
| InChIKey | XTEAXPRBRSLVDI-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|