C24H36O4 — CID 70836812
2-[[(2S)-2,5,7,8-tetramethyl-2-[(E)-non-1-enyl]-3,4-dihydrochromen-6-yl]oxy]acetic acid (PubChem CID 70836812) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is 2-[[(2S)-2,5,7,8-tetramethyl-2-[(E)-non-1-enyl]-3,4-dihydrochromen-6-yl]oxy]acetic acid.
| Compound Name | 2-[[(2S)-2,5,7,8-tetramethyl-2-[(E)-non-1-enyl]-3,4-dihydrochromen-6-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 70836812 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 2-[[(2S)-2,5,7,8-tetramethyl-2-[(E)-non-1-enyl]-3,4-dihydrochromen-6-yl]oxy]acetic acid |
| SMILES | CCCCCCC/C=C/[C@]1(C)CCc2c(C)c(OCC(=O)O)c(C)c(C)c2O1 |
| InChI | InChI=1S/C24H36O4/c1-6-7-8-9-10-11-12-14-24(5)15-13-20-19(4)22(27-16-21(25)26)17(2)18(3)23(20)28-24/h12,14H,6-11,13,15-16H2,1-5H3,(H,25,26)/b14-12+/t24-/m1/s1 |
| InChIKey | JVQMHYXRKLCLRA-SWDTZWKESA-N |
| XLogP | 6.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|