C25H40O5S — CID 59541483
2-[(E)-4,8-dimethylnon-1-enyl]-2,5,7,8-tetramethyl-6-(trioxidanylsulfanylmethoxy)-3,4-dihydrochromene (PubChem CID 59541483) has the molecular formula C25H40O5S and a molecular weight of 452.66 g/mol. Its IUPAC name is 2-[(E)-4,8-dimethylnon-1-enyl]-2,5,7,8-tetramethyl-6-(trioxidanylsulfanylmethoxy)-3,4-dihydrochromene.
| Compound Name | 2-[(E)-4,8-dimethylnon-1-enyl]-2,5,7,8-tetramethyl-6-(trioxidanylsulfanylmethoxy)-3,4-dihydrochromene |
|---|---|
| PubChem CID | 59541483 |
| Molecular Formula | C25H40O5S |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | 2-[(E)-4,8-dimethylnon-1-enyl]-2,5,7,8-tetramethyl-6-(trioxidanylsulfanylmethoxy)-3,4-dihydrochromene |
| SMILES | Cc1c(C)c2c(c(C)c1OCSOOO)CCC(C)(/C=C/CC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C25H40O5S/c1-17(2)10-8-11-18(3)12-9-14-25(7)15-13-22-21(6)23(27-16-31-30-29-26)19(4)20(5)24(22)28-25/h9,14,17-18,26H,8,10-13,15-16H2,1-7H3/b14-9+ |
| InChIKey | MGEWUACXRZNXCD-NTEUORMPSA-N |
| XLogP | 7.51 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|