C20H30O6 — CID 140947917
ethyl (2S)-6-(2-methoxyethoxymethoxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylate (PubChem CID 140947917) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is ethyl (2S)-6-(2-methoxyethoxymethoxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylate.
| Compound Name | ethyl (2S)-6-(2-methoxyethoxymethoxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylate |
|---|---|
| PubChem CID | 140947917 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | ethyl (2S)-6-(2-methoxyethoxymethoxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCc2c(C)c(OCOCCOC)c(C)c(C)c2O1 |
| InChI | InChI=1S/C20H30O6/c1-7-24-19(21)20(5)9-8-16-15(4)17(25-12-23-11-10-22-6)13(2)14(3)18(16)26-20/h7-12H2,1-6H3/t20-/m0/s1 |
| InChIKey | MGCCPECZXFXJOL-FQEVSTJZSA-N |
| XLogP | 3.26 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|