C28H44O4 — CID 10049134
2-[(3E)-4,8-dimethylnona-3,7-dienyl]-6-(2-methoxyethoxymethoxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene (PubChem CID 10049134) has the molecular formula C28H44O4 and a molecular weight of 444.66 g/mol. Its IUPAC name is 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-6-(2-methoxyethoxymethoxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene.
| Compound Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-6-(2-methoxyethoxymethoxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 10049134 |
| Molecular Formula | C28H44O4 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-6-(2-methoxyethoxymethoxy)-2,5,7,8-tetramethyl-3,4-dihydrochromene |
| SMILES | COCCOCOc1c(C)c(C)c2c(c1C)CCC(C)(CC/C=C(\C)CCC=C(C)C)O2 |
| InChI | InChI=1S/C28H44O4/c1-20(2)11-9-12-21(3)13-10-15-28(7)16-14-25-24(6)26(31-19-30-18-17-29-8)22(4)23(5)27(25)32-28/h11,13H,9-10,12,14-19H2,1-8H3/b21-13+ |
| InChIKey | ZENNMLBJXFREIB-FYJGNVAPSA-N |
| XLogP | 7.17 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|