C27H39NO4 — CID 59545058
5-[[2-[(E)-8-cyanooct-1-enyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]pentanoic acid (PubChem CID 59545058) has the molecular formula C27H39NO4 and a molecular weight of 441.61 g/mol. Its IUPAC name is 5-[[2-[(E)-8-cyanooct-1-enyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]pentanoic acid.
| Compound Name | 5-[[2-[(E)-8-cyanooct-1-enyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]pentanoic acid |
|---|---|
| PubChem CID | 59545058 |
| Molecular Formula | C27H39NO4 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | 5-[[2-[(E)-8-cyanooct-1-enyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl]oxy]pentanoic acid |
| SMILES | Cc1c(C)c2c(c(C)c1OCCCCC(=O)O)CCC(C)(/C=C/CCCCCCC#N)O2 |
| InChI | InChI=1S/C27H39NO4/c1-20-21(2)26-23(22(3)25(20)31-19-13-10-14-24(29)30)15-17-27(4,32-26)16-11-8-6-5-7-9-12-18-28/h11,16H,5-10,12-15,17,19H2,1-4H3,(H,29,30)/b16-11+ |
| InChIKey | CVBUSYFTZFRFNC-LFIBNONCSA-N |
| XLogP | 6.75 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|