C25H38O4 — CID 66750244
4-[[2-(4,8-dimethylnon-1-enyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]butanoic acid (PubChem CID 66750244) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is 4-[[2-(4,8-dimethylnon-1-enyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]butanoic acid.
| Compound Name | 4-[[2-(4,8-dimethylnon-1-enyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 66750244 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 4-[[2-(4,8-dimethylnon-1-enyl)-2-methyl-3,4-dihydrochromen-6-yl]oxy]butanoic acid |
| SMILES | CC(C)CCCC(C)CC=CC1(C)CCc2cc(OCCCC(=O)O)ccc2O1 |
| InChI | InChI=1S/C25H38O4/c1-19(2)8-5-9-20(3)10-6-15-25(4)16-14-21-18-22(12-13-23(21)29-25)28-17-7-11-24(26)27/h6,12-13,15,18-20H,5,7-11,14,16-17H2,1-4H3,(H,26,27) |
| InChIKey | IFSHQJYCJIRVAK-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|