C20H27NaO8S2 — CID 173175626
sodium;hydride;1-[4-[4-(1-sulfobutoxy)phenyl]phenoxy]butane-1-sulfonic acid (PubChem CID 173175626) has the molecular formula C20H27NaO8S2 and a molecular weight of 482.55 g/mol. Its IUPAC name is sodium;hydride;1-[4-[4-(1-sulfobutoxy)phenyl]phenoxy]butane-1-sulfonic acid.
| Compound Name | sodium;hydride;1-[4-[4-(1-sulfobutoxy)phenyl]phenoxy]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 173175626 |
| Molecular Formula | C20H27NaO8S2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | sodium;hydride;1-[4-[4-(1-sulfobutoxy)phenyl]phenoxy]butane-1-sulfonic acid |
| SMILES | CCCC(Oc1ccc(-c2ccc(OC(CCC)S(=O)(=O)O)cc2)cc1)S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C20H26O8S2.Na.H/c1-3-5-19(29(21,22)23)27-17-11-7-15(8-12-17)16-9-13-18(14-10-16)28-20(6-4-2)30(24,25)26;;/h7-14,19-20H,3-6H2,1-2H3,(H,21,22,23)(H,24,25,26);;/q;+1;-1 |
| InChIKey | HJWGQGXFTYAYCA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|