C18H24O8S2 — CID 87094783
1-[5-(1-sulfobutoxy)naphthalen-1-yl]oxybutane-1-sulfonic acid (PubChem CID 87094783) has the molecular formula C18H24O8S2 and a molecular weight of 432.52 g/mol. Its IUPAC name is 1-[5-(1-sulfobutoxy)naphthalen-1-yl]oxybutane-1-sulfonic acid.
| Compound Name | 1-[5-(1-sulfobutoxy)naphthalen-1-yl]oxybutane-1-sulfonic acid |
|---|---|
| PubChem CID | 87094783 |
| Molecular Formula | C18H24O8S2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 1-[5-(1-sulfobutoxy)naphthalen-1-yl]oxybutane-1-sulfonic acid |
| SMILES | CCCC(Oc1cccc2c(OC(CCC)S(=O)(=O)O)cccc12)S(=O)(=O)O |
| InChI | InChI=1S/C18H24O8S2/c1-3-7-17(27(19,20)21)25-15-11-5-10-14-13(15)9-6-12-16(14)26-18(8-4-2)28(22,23)24/h5-6,9-12,17-18H,3-4,7-8H2,1-2H3,(H,19,20,21)(H,22,23,24) |
| InChIKey | WQIXIWIOUDFQAI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|