C18H24O6S2 — CID 174257526
1-O-naphthalen-1-yl 1-O'-propan-2-yl pentane-1,1-disulfonate (PubChem CID 174257526) has the molecular formula C18H24O6S2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 1-O-naphthalen-1-yl 1-O'-propan-2-yl pentane-1,1-disulfonate.
| Compound Name | 1-O-naphthalen-1-yl 1-O'-propan-2-yl pentane-1,1-disulfonate |
|---|---|
| PubChem CID | 174257526 |
| Molecular Formula | C18H24O6S2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 1-O-naphthalen-1-yl 1-O'-propan-2-yl pentane-1,1-disulfonate |
| SMILES | CCCCC(S(=O)(=O)Oc1cccc2ccccc12)S(=O)(=O)OC(C)C |
| InChI | InChI=1S/C18H24O6S2/c1-4-5-13-18(25(19,20)23-14(2)3)26(21,22)24-17-12-8-10-15-9-6-7-11-16(15)17/h6-12,14,18H,4-5,13H2,1-3H3 |
| InChIKey | MLSGEJPIDIFPIX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|