C13H20O3 — CID 107892192
(3-methoxy-2-pentan-2-yloxyphenyl)methanol (PubChem CID 107892192) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (3-methoxy-2-pentan-2-yloxyphenyl)methanol.
| Compound Name | (3-methoxy-2-pentan-2-yloxyphenyl)methanol |
|---|---|
| PubChem CID | 107892192 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (3-methoxy-2-pentan-2-yloxyphenyl)methanol |
| SMILES | CCCC(C)Oc1c(CO)cccc1OC |
| InChI | InChI=1S/C13H20O3/c1-4-6-10(2)16-13-11(9-14)7-5-8-12(13)15-3/h5,7-8,10,14H,4,6,9H2,1-3H3 |
| InChIKey | YIMHHQGFSQRDFW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |