C12H17FO2 — CID 107892337
(3-fluoro-2-pentan-2-yloxyphenyl)methanol (PubChem CID 107892337) has the molecular formula C12H17FO2 and a molecular weight of 212.26 g/mol. Its IUPAC name is (3-fluoro-2-pentan-2-yloxyphenyl)methanol.
| Compound Name | (3-fluoro-2-pentan-2-yloxyphenyl)methanol |
|---|---|
| PubChem CID | 107892337 |
| Molecular Formula | C12H17FO2 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (3-fluoro-2-pentan-2-yloxyphenyl)methanol |
| SMILES | CCCC(C)Oc1c(F)cccc1CO |
| InChI | InChI=1S/C12H17FO2/c1-3-5-9(2)15-12-10(8-14)6-4-7-11(12)13/h4,6-7,9,14H,3,5,8H2,1-2H3 |
| InChIKey | SNZXDQIOEZFZRW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |