C29H48O3 — CID 135073265
[(3R)-3,5-dimethyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]-1,4-dihydroisochromen-7-yl] acetate (PubChem CID 135073265) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is [(3R)-3,5-dimethyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]-1,4-dihydroisochromen-7-yl] acetate.
| Compound Name | [(3R)-3,5-dimethyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]-1,4-dihydroisochromen-7-yl] acetate |
|---|---|
| PubChem CID | 135073265 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | [(3R)-3,5-dimethyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]-1,4-dihydroisochromen-7-yl] acetate |
| SMILES | CC(=O)Oc1cc(C)c2c(c1)CO[C@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C2 |
| InChI | InChI=1S/C29H48O3/c1-21(2)11-8-12-22(3)13-9-14-23(4)15-10-16-29(7)19-28-24(5)17-27(32-25(6)30)18-26(28)20-31-29/h17-18,21-23H,8-16,19-20H2,1-7H3/t22-,23-,29-/m1/s1 |
| InChIKey | XSTXZASUCKERKQ-VDWGHMIBSA-N |
| XLogP | 8.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|