C19H38O — CID 11022381
(2R)-2-methyl-2-(4,8,12-trimethyltridecyl)oxirane (PubChem CID 11022381) has the molecular formula C19H38O and a molecular weight of 282.51 g/mol. Its IUPAC name is (2R)-2-methyl-2-(4,8,12-trimethyltridecyl)oxirane.
| Compound Name | (2R)-2-methyl-2-(4,8,12-trimethyltridecyl)oxirane |
|---|---|
| PubChem CID | 11022381 |
| Molecular Formula | C19H38O |
| Molecular Weight | 282.51 g/mol |
| Exact Mass | 282.29 |
| IUPAC Name | (2R)-2-methyl-2-(4,8,12-trimethyltridecyl)oxirane |
| SMILES | CC(C)CCCC(C)CCCC(C)CCC[C@]1(C)CO1 |
| InChI | InChI=1S/C19H38O/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20-19/h16-18H,6-15H2,1-5H3/t17?,18?,19-/m1/s1 |
| InChIKey | JCBKDEPTGAMOKJ-CTWPCTMYSA-N |
| XLogP | 6.21 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.51 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|