C12H22O3 — CID 14470430
[(3R)-5-[(2S)-3,3-dimethyloxiran-2-yl]-3-methylpentyl] acetate (PubChem CID 14470430) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is [(3R)-5-[(2S)-3,3-dimethyloxiran-2-yl]-3-methylpentyl] acetate.
| Compound Name | [(3R)-5-[(2S)-3,3-dimethyloxiran-2-yl]-3-methylpentyl] acetate |
|---|---|
| PubChem CID | 14470430 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | [(3R)-5-[(2S)-3,3-dimethyloxiran-2-yl]-3-methylpentyl] acetate |
| SMILES | CC(=O)OCC[C@H](C)CC[C@@H]1OC1(C)C |
| InChI | InChI=1S/C12H22O3/c1-9(7-8-14-10(2)13)5-6-11-12(3,4)15-11/h9,11H,5-8H2,1-4H3/t9-,11+/m1/s1 |
| InChIKey | MRGMCVIMBUZMEC-KOLCDFICSA-N |
| XLogP | 2.53 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|