About [(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl acetate
[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl acetate (PubChem CID 14238819) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is [(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl acetate.
Analyze [(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl acetate?
The IUPAC name of [(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl acetate (CID 14238819) is [(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl acetate.
What is the SMILES notation for [(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl acetate?
The canonical SMILES for [(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl acetate is CC(=O)OC[C@@H]1OC(C)(C)OC1(C)C.
What is the InChIKey of [(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl acetate?
The InChIKey is JBOSCLATGFUWDA-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H18O4/c1-7(11)12-6-8-9(2,3)14-10(4,5)13-8/h8H,6H2,1-5H3/t8-/m0/s1.
What are the key properties of [(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl acetate?
[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl acetate has a molecular weight of 202.25 g/mol, XLogP of 1.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl acetate is sourced from PubChem (CID 14238819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).