C10H20O2 — CID 90020662
2,5-dimethylhexyl acetate (PubChem CID 90020662) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is 2,5-dimethylhexyl acetate.
| Compound Name | 2,5-dimethylhexyl acetate |
|---|---|
| PubChem CID | 90020662 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 2,5-dimethylhexyl acetate |
| SMILES | CC(=O)OCC(C)CCC(C)C |
| InChI | InChI=1S/C10H20O2/c1-8(2)5-6-9(3)7-12-10(4)11/h8-9H,5-7H2,1-4H3 |
| InChIKey | WPOHDQWGBKILAQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |