About 2-methylpropyl acetate;hydrate
2-methylpropyl acetate;hydrate (PubChem CID 86585368) has the molecular formula C6H14O3
and a molecular weight of 134.18 g/mol. Its IUPAC name is 2-methylpropyl acetate;hydrate.
Molecular Properties
| Compound Name | 2-methylpropyl acetate;hydrate |
| PubChem CID | 86585368 |
| Molecular Formula | C6H14O3 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | 2-methylpropyl acetate;hydrate |
| SMILES | CC(=O)OCC(C)C.O |
| InChI | InChI=1S/C6H12O2.H2O/c1-5(2)4-8-6(3)7;/h5H,4H2,1-3H3;1H2 |
| InChIKey | BOTAPQORJZUTIZ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 57.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpropyl acetate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl acetate;hydrate?
The IUPAC name of 2-methylpropyl acetate;hydrate (CID 86585368) is 2-methylpropyl acetate;hydrate.
What is the SMILES notation for 2-methylpropyl acetate;hydrate?
The canonical SMILES for 2-methylpropyl acetate;hydrate is CC(=O)OCC(C)C.O.
What is the InChIKey of 2-methylpropyl acetate;hydrate?
The InChIKey is BOTAPQORJZUTIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.H2O/c1-5(2)4-8-6(3)7;/h5H,4H2,1-3H3;1H2.
What are the key properties of 2-methylpropyl acetate;hydrate?
2-methylpropyl acetate;hydrate has a molecular weight of 134.18 g/mol, XLogP of 0.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl acetate;hydrate is sourced from PubChem (CID 86585368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).