About 2-chloropropyl acetate
2-chloropropyl acetate (PubChem CID 527885) has the molecular formula C5H9ClO2
and a molecular weight of 136.58 g/mol. Its IUPAC name is 2-chloropropyl acetate.
Molecular Properties
| Compound Name | 2-chloropropyl acetate |
| PubChem CID | 527885 |
| Molecular Formula | C5H9ClO2 |
| Molecular Weight | 136.58 g/mol |
| Exact Mass | 136.03 |
| IUPAC Name | 2-chloropropyl acetate |
| SMILES | CC(=O)OCC(C)Cl |
| InChI | InChI=1S/C5H9ClO2/c1-4(6)3-8-5(2)7/h4H,3H2,1-2H3 |
| InChIKey | DXCQFTYOBQILML-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.58 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloropropyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropropyl acetate?
The IUPAC name of 2-chloropropyl acetate (CID 527885) is 2-chloropropyl acetate.
What is the SMILES notation for 2-chloropropyl acetate?
The canonical SMILES for 2-chloropropyl acetate is CC(=O)OCC(C)Cl.
What is the InChIKey of 2-chloropropyl acetate?
The InChIKey is DXCQFTYOBQILML-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClO2/c1-4(6)3-8-5(2)7/h4H,3H2,1-2H3.
What are the key properties of 2-chloropropyl acetate?
2-chloropropyl acetate has a molecular weight of 136.58 g/mol, XLogP of 1.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropropyl acetate is sourced from PubChem (CID 527885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).