C26H48O5Si — CID 134942520
[(E)-2-methyl-5-[(2R,3R)-2-methyl-3-[2-[(2S,3S)-2-methyl-3-[tri(propan-2-yl)silyloxymethyl]oxiran-2-yl]ethyl]oxiran-2-yl]pent-2-enyl] acetate (PubChem CID 134942520) has the molecular formula C26H48O5Si and a molecular weight of 468.75 g/mol. Its IUPAC name is [(E)-2-methyl-5-[(2R,3R)-2-methyl-3-[2-[(2S,3S)-2-methyl-3-[tri(propan-2-yl)silyloxymethyl]oxiran-2-yl]ethyl]oxiran-2-yl]pent-2-enyl] acetate.
| Compound Name | [(E)-2-methyl-5-[(2R,3R)-2-methyl-3-[2-[(2S,3S)-2-methyl-3-[tri(propan-2-yl)silyloxymethyl]oxiran-2-yl]ethyl]oxiran-2-yl]pent-2-enyl] acetate |
|---|---|
| PubChem CID | 134942520 |
| Molecular Formula | C26H48O5Si |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | [(E)-2-methyl-5-[(2R,3R)-2-methyl-3-[2-[(2S,3S)-2-methyl-3-[tri(propan-2-yl)silyloxymethyl]oxiran-2-yl]ethyl]oxiran-2-yl]pent-2-enyl] acetate |
| SMILES | CC(=O)OC/C(C)=C/CC[C@@]1(C)O[C@@H]1CC[C@]1(C)O[C@H]1CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H48O5Si/c1-18(2)32(19(3)4,20(5)6)29-17-24-26(10,31-24)15-13-23-25(9,30-23)14-11-12-21(7)16-28-22(8)27/h12,18-20,23-24H,11,13-17H2,1-10H3/b21-12+/t23-,24+,25-,26+/m1/s1 |
| InChIKey | IZSDPUDMZUCCGR-AATZCBHDSA-N |
| XLogP | 6.56 |
| TPSA | 60.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|