C23H38O2 — CID 175675030
4-[3-methyl-3-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxiran-2-yl]butan-2-one (PubChem CID 175675030) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is 4-[3-methyl-3-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxiran-2-yl]butan-2-one.
| Compound Name | 4-[3-methyl-3-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxiran-2-yl]butan-2-one |
|---|---|
| PubChem CID | 175675030 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | 4-[3-methyl-3-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxiran-2-yl]butan-2-one |
| SMILES | CC(=O)CCC1OC1(C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C23H38O2/c1-18(2)10-7-11-19(3)12-8-13-20(4)14-9-17-23(6)22(25-23)16-15-21(5)24/h10,12,14,22H,7-9,11,13,15-17H2,1-6H3/b19-12+,20-14+ |
| InChIKey | SVKHNIXIALHTOE-LCAIAVFMSA-N |
| XLogP | 6.71 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|