C17H24O2 — CID 3310372
9-(3-but-3-ynyl-2-methyloxiran-2-yl)-6-methylnona-2,6-dienal (PubChem CID 3310372) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 9-(3-but-3-ynyl-2-methyloxiran-2-yl)-6-methylnona-2,6-dienal.
| Compound Name | 9-(3-but-3-ynyl-2-methyloxiran-2-yl)-6-methylnona-2,6-dienal |
|---|---|
| PubChem CID | 3310372 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 9-(3-but-3-ynyl-2-methyloxiran-2-yl)-6-methylnona-2,6-dienal |
| SMILES | C#CCCC1OC1(C)CCC=C(C)CCC=CC=O |
| InChI | InChI=1S/C17H24O2/c1-4-5-12-16-17(3,19-16)13-9-11-15(2)10-7-6-8-14-18/h1,6,8,11,14,16H,5,7,9-10,12-13H2,2-3H3 |
| InChIKey | AQVYZWCGELYKDV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|