C21H34OS — CID 101244322
3-[(3E,7E,11E,13E)-3,7-dimethyl-14-methylsulfanyltetradeca-3,7,11,13-tetraenyl]-2,2-dimethyloxirane (PubChem CID 101244322) has the molecular formula C21H34OS and a molecular weight of 334.57 g/mol. Its IUPAC name is 3-[(3E,7E,11E,13E)-3,7-dimethyl-14-methylsulfanyltetradeca-3,7,11,13-tetraenyl]-2,2-dimethyloxirane.
| Compound Name | 3-[(3E,7E,11E,13E)-3,7-dimethyl-14-methylsulfanyltetradeca-3,7,11,13-tetraenyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 101244322 |
| Molecular Formula | C21H34OS |
| Molecular Weight | 334.57 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 3-[(3E,7E,11E,13E)-3,7-dimethyl-14-methylsulfanyltetradeca-3,7,11,13-tetraenyl]-2,2-dimethyloxirane |
| SMILES | CS/C=C/C=C/CC/C=C(\C)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C21H34OS/c1-18(12-9-7-6-8-10-17-23-5)13-11-14-19(2)15-16-20-21(3,4)22-20/h6,8,10,12,14,17,20H,7,9,11,13,15-16H2,1-5H3/b8-6+,17-10+,18-12+,19-14+ |
| InChIKey | JICFXWFJGGWHNO-IUOFAUTFSA-N |
| XLogP | 6.83 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.57 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|