C20H33BrO — CID 11783576
(3S)-3-[(3E,7E,11E)-13-bromo-3,7,11-trimethyltrideca-3,7,11-trienyl]-2,2-dimethyloxirane (PubChem CID 11783576) has the molecular formula C20H33BrO and a molecular weight of 369.39 g/mol. Its IUPAC name is (3S)-3-[(3E,7E,11E)-13-bromo-3,7,11-trimethyltrideca-3,7,11-trienyl]-2,2-dimethyloxirane.
| Compound Name | (3S)-3-[(3E,7E,11E)-13-bromo-3,7,11-trimethyltrideca-3,7,11-trienyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 11783576 |
| Molecular Formula | C20H33BrO |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (3S)-3-[(3E,7E,11E)-13-bromo-3,7,11-trimethyltrideca-3,7,11-trienyl]-2,2-dimethyloxirane |
| SMILES | C/C(=C\CBr)CC/C=C(\C)CC/C=C(\C)CC[C@@H]1OC1(C)C |
| InChI | InChI=1S/C20H33BrO/c1-16(9-7-11-18(3)14-15-21)8-6-10-17(2)12-13-19-20(4,5)22-19/h9-10,14,19H,6-8,11-13,15H2,1-5H3/b16-9+,17-10+,18-14+/t19-/m0/s1 |
| InChIKey | JQDRIGKOAMTQBP-CRVSJLGISA-N |
| XLogP | 6.74 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|