C16H25NO — CID 135009471
(3E)-10-(3,3-dimethyloxiran-2-yl)-4,8-dimethyldeca-3,7-dienenitrile (PubChem CID 135009471) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (3E)-10-(3,3-dimethyloxiran-2-yl)-4,8-dimethyldeca-3,7-dienenitrile.
| Compound Name | (3E)-10-(3,3-dimethyloxiran-2-yl)-4,8-dimethyldeca-3,7-dienenitrile |
|---|---|
| PubChem CID | 135009471 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (3E)-10-(3,3-dimethyloxiran-2-yl)-4,8-dimethyldeca-3,7-dienenitrile |
| SMILES | CC(=CCC/C(C)=C/CC#N)CCC1OC1(C)C |
| InChI | InChI=1S/C16H25NO/c1-13(9-6-12-17)7-5-8-14(2)10-11-15-16(3,4)18-15/h8-9,15H,5-7,10-11H2,1-4H3/b13-9+,14-8? |
| InChIKey | QAIVYGAQKNHNTG-BYZOIJCFSA-N |
| XLogP | 4.53 |
| TPSA | 36.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|