C17H27NO — CID 155935115
(4E,8E)-11-[(2S)-3,3-dimethyloxiran-2-yl]-5,9-dimethylundeca-4,8-dienenitrile (PubChem CID 155935115) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is (4E,8E)-11-[(2S)-3,3-dimethyloxiran-2-yl]-5,9-dimethylundeca-4,8-dienenitrile.
| Compound Name | (4E,8E)-11-[(2S)-3,3-dimethyloxiran-2-yl]-5,9-dimethylundeca-4,8-dienenitrile |
|---|---|
| PubChem CID | 155935115 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | (4E,8E)-11-[(2S)-3,3-dimethyloxiran-2-yl]-5,9-dimethylundeca-4,8-dienenitrile |
| SMILES | C/C(=C\CCC#N)CC/C=C(\C)CC[C@@H]1OC1(C)C |
| InChI | InChI=1S/C17H27NO/c1-14(8-5-6-13-18)9-7-10-15(2)11-12-16-17(3,4)19-16/h8,10,16H,5-7,9,11-12H2,1-4H3/b14-8+,15-10+/t16-/m0/s1 |
| InChIKey | JRRNXZYOAUXMEQ-ZBEHIFCESA-N |
| XLogP | 4.92 |
| TPSA | 36.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|