C24H40OS — CID 101117780
2,2-dimethyl-3-[(3E,7E,11E,15E)-3,7,12-trimethyl-16-methylsulfanylhexadeca-3,7,11,15-tetraenyl]oxirane (PubChem CID 101117780) has the molecular formula C24H40OS and a molecular weight of 376.65 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(3E,7E,11E,15E)-3,7,12-trimethyl-16-methylsulfanylhexadeca-3,7,11,15-tetraenyl]oxirane.
| Compound Name | 2,2-dimethyl-3-[(3E,7E,11E,15E)-3,7,12-trimethyl-16-methylsulfanylhexadeca-3,7,11,15-tetraenyl]oxirane |
|---|---|
| PubChem CID | 101117780 |
| Molecular Formula | C24H40OS |
| Molecular Weight | 376.65 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 2,2-dimethyl-3-[(3E,7E,11E,15E)-3,7,12-trimethyl-16-methylsulfanylhexadeca-3,7,11,15-tetraenyl]oxirane |
| SMILES | CS/C=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C24H40OS/c1-20(14-9-10-19-26-6)12-7-8-13-21(2)15-11-16-22(3)17-18-23-24(4,5)25-23/h10,12-13,16,19,23H,7-9,11,14-15,17-18H2,1-6H3/b19-10+,20-12+,21-13+,22-16+ |
| InChIKey | PEUHATCZOAPGLS-LKZFHFDOSA-N |
| XLogP | 8.00 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.65 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|