C23H42O2Si — CID 10068249
(2E,6E,10E)-13-[(2S)-3,3-dimethyloxiran-2-yl]-3,11-dimethyl-7-(trimethylsilylmethyl)trideca-2,6,10-trien-1-ol (PubChem CID 10068249) has the molecular formula C23H42O2Si and a molecular weight of 378.67 g/mol. Its IUPAC name is (2E,6E,10E)-13-[(2S)-3,3-dimethyloxiran-2-yl]-3,11-dimethyl-7-(trimethylsilylmethyl)trideca-2,6,10-trien-1-ol.
| Compound Name | (2E,6E,10E)-13-[(2S)-3,3-dimethyloxiran-2-yl]-3,11-dimethyl-7-(trimethylsilylmethyl)trideca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 10068249 |
| Molecular Formula | C23H42O2Si |
| Molecular Weight | 378.67 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | (2E,6E,10E)-13-[(2S)-3,3-dimethyloxiran-2-yl]-3,11-dimethyl-7-(trimethylsilylmethyl)trideca-2,6,10-trien-1-ol |
| SMILES | C/C(=C\CO)CC/C=C(\CC/C=C(\C)CC[C@@H]1OC1(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C23H42O2Si/c1-19(14-15-22-23(3,4)25-22)10-8-12-21(18-26(5,6)7)13-9-11-20(2)16-17-24/h10,13,16,22,24H,8-9,11-12,14-15,17-18H2,1-7H3/b19-10+,20-16+,21-13+/t22-/m0/s1 |
| InChIKey | QCVFZGAPRKLTCW-AGKJJYEVSA-N |
| XLogP | 6.65 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.67 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|