C16H28O2 — CID 101236693
(2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3-ethyl-7-methylnona-2,6-dien-1-ol (PubChem CID 101236693) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3-ethyl-7-methylnona-2,6-dien-1-ol.
| Compound Name | (2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3-ethyl-7-methylnona-2,6-dien-1-ol |
|---|---|
| PubChem CID | 101236693 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3-ethyl-7-methylnona-2,6-dien-1-ol |
| SMILES | CC/C(=C\CO)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C16H28O2/c1-5-14(11-12-17)8-6-7-13(2)9-10-15-16(3,4)18-15/h7,11,15,17H,5-6,8-10,12H2,1-4H3/b13-7+,14-11+ |
| InChIKey | BXUCEXAIABUYPR-FYCHQBGDSA-N |
| XLogP | 4.00 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|